Incoloy825(N08825/NS142/2.4858) nut

Similar grades

GB/T	UNS	Trademark	JIS	W.Nr
NS142	N08825	Incoloy825	NCF825	2.4858

 

Chemical composition of Incoloy825 nut:

Alloy	%	Ni	Cr	Fe	C	Mn	Si	Cu	Mo	Al	Ti	P	S
Incoloy825	Min	38	19.5	Balance				1.5	2.5		0.6
	Max	46	23.5		0.05	1.0	0.5	3	3.5	0.2	1.2	0.03	0.03

 

physical properties of Incoloy825 nuts:

density	8.14g/cm³
melting point	1370~1400°c

 

The minimum mechanical properties of the Incoloy825 nut alloy at room temperature:

Alloy status	tensile strength Rm N/mm2	Yield Strength RP0.2 N/mm2	Elongation A5%	Brinell hardness HB
Solid solution	550	220	30	≤200

 

Incoloy825 nuts have the following characteristics

1. Good resistance to stress corrosion cracking
2. Good resistance to pitting corrosion and crevice corrosion
3. Very good antioxidant and non-oxidizing hot acid properties
4. It has good mechanical properties at room temperature and high temperatures up to 550℃
5. Certification for pressure vessels with manufacturing temperatures up to 450°C

 

Corrosion resistance of Incoloy825 nuts:

Alloy 825 is a general engineering alloy that is resistant to acid and alkali metal corrosion in both oxidizing and reducing environments. The high nickel content makes the alloy effectively resistant to stress corrosion cracking. It has good corrosion resistance in various media, such as sulfuric acid, phosphoric acid, nitric acid and organic acids, alkali metals such as sodium hydroxide, potassium hydroxide and hydrochloric acid solution. The higher comprehensive performance of 825 alloy is demonstrated in nuclear combustion dissolvers with various corrosive media, such as sulfuric acid, nitric acid and sodium hydroxide, all processed in the same equipment.

 

Incoloy825 nut application range application areas are:

825 alloy is widely used in various industrial fields where the operating temperature does not exceed 550°C.

 

Typical applications of Incoloy825 nuts are:

1. Heating tubes, containers, baskets and chains used in sulfuric acid pickling factories.
2. Seawater cooling heat exchangers, marine product pipeline systems, acid gas environment pipelines.
3. Heat exchangers, evaporators, washing, dipping tubes, etc. in phosphoric acid production.
4. Air heat exchanger in petroleum refining
5. Food Engineering
6. Chemical process
7. Flame retardant alloys for high pressure oxygen applications